C6H5N3O — CID 146285501
5-hydrazinyl-2-azabicyclo[4.1.0]hepta-1,3,5-trien-7-one (PubChem CID 146285501) has the molecular formula C6H5N3O and a molecular weight of 135.13 g/mol. Its IUPAC name is 5-hydrazinyl-2-azabicyclo[4.1.0]hepta-1,3,5-trien-7-one.
| Compound Name | 5-hydrazinyl-2-azabicyclo[4.1.0]hepta-1,3,5-trien-7-one |
|---|---|
| PubChem CID | 146285501 |
| Molecular Formula | C6H5N3O |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | 5-hydrazinyl-2-azabicyclo[4.1.0]hepta-1,3,5-trien-7-one |
| SMILES | NNc1ccnc2c(=O)c12 |
| InChI | InChI=1S/C6H5N3O/c7-9-3-1-2-8-5-4(3)6(5)10/h1-2H,7H2,(H,8,9) |
| InChIKey | UULPHFJMIURRTO-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|