C9H12N4 — CID 165474233
(3-ethyl-1H-pyrrolo[2,3-b]pyridin-4-yl)hydrazine (PubChem CID 165474233) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is (3-ethyl-1H-pyrrolo[2,3-b]pyridin-4-yl)hydrazine.
| Compound Name | (3-ethyl-1H-pyrrolo[2,3-b]pyridin-4-yl)hydrazine |
|---|---|
| PubChem CID | 165474233 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | (3-ethyl-1H-pyrrolo[2,3-b]pyridin-4-yl)hydrazine |
| SMILES | CCc1c[nH]c2nccc(NN)c12 |
| InChI | InChI=1S/C9H12N4/c1-2-6-5-12-9-8(6)7(13-10)3-4-11-9/h3-5H,2,10H2,1H3,(H2,11,12,13) |
| InChIKey | JTKATDZXUHRRSZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|