C16H18N4O — CID 122697140
(Z)-2-acetyl-4-[4-(propan-2-ylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]but-2-enenitrile (PubChem CID 122697140) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is (Z)-2-acetyl-4-[4-(propan-2-ylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]but-2-enenitrile.
| Compound Name | (Z)-2-acetyl-4-[4-(propan-2-ylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]but-2-enenitrile |
|---|---|
| PubChem CID | 122697140 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (Z)-2-acetyl-4-[4-(propan-2-ylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]but-2-enenitrile |
| SMILES | CC(=O)/C(C#N)=C\Cc1c[nH]c2nccc(NC(C)C)c12 |
| InChI | InChI=1S/C16H18N4O/c1-10(2)20-14-6-7-18-16-15(14)13(9-19-16)5-4-12(8-17)11(3)21/h4,6-7,9-10H,5H2,1-3H3,(H2,18,19,20)/b12-4- |
| InChIKey | GSHBTIPYINGQRK-QCDXTXTGSA-N |
| XLogP | 2.96 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|