C14H14N4O4 — CID 54274379
2-cyano-3-[4-(2,3-dihydroxypropoxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide (PubChem CID 54274379) has the molecular formula C14H14N4O4 and a molecular weight of 302.29 g/mol. Its IUPAC name is 2-cyano-3-[4-(2,3-dihydroxypropoxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide.
| Compound Name | 2-cyano-3-[4-(2,3-dihydroxypropoxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 54274379 |
| Molecular Formula | C14H14N4O4 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2-cyano-3-[4-(2,3-dihydroxypropoxy)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide |
| SMILES | N#CC(=Cc1c[nH]c2nccc(OCC(O)CO)c12)C(N)=O |
| InChI | InChI=1S/C14H14N4O4/c15-4-8(13(16)21)3-9-5-18-14-12(9)11(1-2-17-14)22-7-10(20)6-19/h1-3,5,10,19-20H,6-7H2,(H2,16,21)(H,17,18) |
| InChIKey | RMJODPGCWVBESA-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 145.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|