C16H12N6O — CID 118267938
(E)-2-cyano-4-(2-pyridin-2-yl-5H-pyrrolo[2,3-b]pyrazin-7-yl)but-2-enamide (PubChem CID 118267938) has the molecular formula C16H12N6O and a molecular weight of 304.31 g/mol. Its IUPAC name is (E)-2-cyano-4-(2-pyridin-2-yl-5H-pyrrolo[2,3-b]pyrazin-7-yl)but-2-enamide.
| Compound Name | (E)-2-cyano-4-(2-pyridin-2-yl-5H-pyrrolo[2,3-b]pyrazin-7-yl)but-2-enamide |
|---|---|
| PubChem CID | 118267938 |
| Molecular Formula | C16H12N6O |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (E)-2-cyano-4-(2-pyridin-2-yl-5H-pyrrolo[2,3-b]pyrazin-7-yl)but-2-enamide |
| SMILES | N#C/C(=C\Cc1c[nH]c2ncc(-c3ccccn3)nc12)C(N)=O |
| InChI | InChI=1S/C16H12N6O/c17-7-10(15(18)23)4-5-11-8-20-16-14(11)22-13(9-21-16)12-3-1-2-6-19-12/h1-4,6,8-9H,5H2,(H2,18,23)(H,20,21)/b10-4+ |
| InChIKey | QGGZUFLOZOYSCI-ONNFQVAWSA-N |
| XLogP | 1.50 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|