C17H11F3N6O2 — CID 118267930
(E)-2-cyano-3-[2-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide (PubChem CID 118267930) has the molecular formula C17H11F3N6O2 and a molecular weight of 388.31 g/mol. Its IUPAC name is (E)-2-cyano-3-[2-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[2-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide |
|---|---|
| PubChem CID | 118267930 |
| Molecular Formula | C17H11F3N6O2 |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | (E)-2-cyano-3-[2-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide |
| SMILES | N#C/C(=C\c1c[nH]c2ncc(-c3ccc(OCC(F)(F)F)nc3)nc12)C(N)=O |
| InChI | InChI=1S/C17H11F3N6O2/c18-17(19,20)8-28-13-2-1-9(5-23-13)12-7-25-16-14(26-12)11(6-24-16)3-10(4-21)15(22)27/h1-3,5-7H,8H2,(H2,22,27)(H,24,25)/b10-3+ |
| InChIKey | KYVJLKMTZQLYHW-XCVCLJGOSA-N |
| XLogP | 2.35 |
| TPSA | 130.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|