C15H10N6O — CID 123582062
(E)-3-[2-(6-isocyano-3-pyridinyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide (PubChem CID 123582062) has the molecular formula C15H10N6O and a molecular weight of 290.29 g/mol. Its IUPAC name is (E)-3-[2-(6-isocyano-3-pyridinyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide.
| Compound Name | (E)-3-[2-(6-isocyano-3-pyridinyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide |
|---|---|
| PubChem CID | 123582062 |
| Molecular Formula | C15H10N6O |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (E)-3-[2-(6-isocyano-3-pyridinyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide |
| SMILES | [C-]#[N+]c1ccc(-c2cnc3[nH]cc(/C=C/C(N)=O)c3n2)cn1 |
| InChI | InChI=1S/C15H10N6O/c1-17-13-5-3-9(6-18-13)11-8-20-15-14(21-11)10(7-19-15)2-4-12(16)22/h2-8H,(H2,16,22)(H,19,20)/b4-2+ |
| InChIKey | TUPIIMURHAYHTM-DUXPYHPUSA-N |
| XLogP | 2.07 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|