C16H11N5O — CID 123655456
(E)-3-[5-(6-isocyano-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide (PubChem CID 123655456) has the molecular formula C16H11N5O and a molecular weight of 289.30 g/mol. Its IUPAC name is (E)-3-[5-(6-isocyano-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide.
| Compound Name | (E)-3-[5-(6-isocyano-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 123655456 |
| Molecular Formula | C16H11N5O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | (E)-3-[5-(6-isocyano-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide |
| SMILES | [C-]#[N+]c1ccc(-c2cnc3[nH]cc(/C=C/C(N)=O)c3c2)cn1 |
| InChI | InChI=1S/C16H11N5O/c1-18-15-5-3-10(7-19-15)12-6-13-11(2-4-14(17)22)8-20-16(13)21-9-12/h2-9H,(H2,17,22)(H,20,21)/b4-2+ |
| InChIKey | JSUHYXKFCSLLIQ-DUXPYHPUSA-N |
| XLogP | 2.67 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|