C20H21N5O — CID 123739902
3-[5-(6-piperidin-1-yl-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide (PubChem CID 123739902) has the molecular formula C20H21N5O and a molecular weight of 347.42 g/mol. Its IUPAC name is 3-[5-(6-piperidin-1-yl-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide.
| Compound Name | 3-[5-(6-piperidin-1-yl-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 123739902 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 3-[5-(6-piperidin-1-yl-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide |
| SMILES | NC(=O)C=Cc1c[nH]c2ncc(-c3ccc(N4CCCCC4)nc3)cc12 |
| InChI | InChI=1S/C20H21N5O/c21-18(26)6-4-15-12-23-20-17(15)10-16(13-24-20)14-5-7-19(22-11-14)25-8-2-1-3-9-25/h4-7,10-13H,1-3,8-9H2,(H2,21,26)(H,23,24) |
| InChIKey | DXJLRAOBRBBNCD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|