C18H15N5O2 — CID 140752855
(E)-3-[5-[1-(2-isocyanoethyl)-6-oxo-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide (PubChem CID 140752855) has the molecular formula C18H15N5O2 and a molecular weight of 333.35 g/mol. Its IUPAC name is (E)-3-[5-[1-(2-isocyanoethyl)-6-oxo-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide.
| Compound Name | (E)-3-[5-[1-(2-isocyanoethyl)-6-oxo-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 140752855 |
| Molecular Formula | C18H15N5O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (E)-3-[5-[1-(2-isocyanoethyl)-6-oxo-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide |
| SMILES | [C-]#[N+]CCn1cc(-c2cnc3[nH]cc(/C=C/C(N)=O)c3c2)ccc1=O |
| InChI | InChI=1S/C18H15N5O2/c1-20-6-7-23-11-13(3-5-17(23)25)14-8-15-12(2-4-16(19)24)9-21-18(15)22-10-14/h2-5,8-11H,6-7H2,(H2,19,24)(H,21,22)/b4-2+ |
| InChIKey | DRBSHTSZJJOJHB-DUXPYHPUSA-N |
| XLogP | 1.81 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|