C16H13FN4O — CID 122705548
(E)-3-[2-(4-fluoro-3-methylphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide (PubChem CID 122705548) has the molecular formula C16H13FN4O and a molecular weight of 296.31 g/mol. Its IUPAC name is (E)-3-[2-(4-fluoro-3-methylphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide.
| Compound Name | (E)-3-[2-(4-fluoro-3-methylphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide |
|---|---|
| PubChem CID | 122705548 |
| Molecular Formula | C16H13FN4O |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | (E)-3-[2-(4-fluoro-3-methylphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide |
| SMILES | Cc1cc(-c2cnc3[nH]cc(/C=C/C(N)=O)c3n2)ccc1F |
| InChI | InChI=1S/C16H13FN4O/c1-9-6-10(2-4-12(9)17)13-8-20-16-15(21-13)11(7-19-16)3-5-14(18)22/h2-8H,1H3,(H2,18,22)(H,19,20)/b5-3+ |
| InChIKey | CDVQGWDXZUCCHF-HWKANZROSA-N |
| XLogP | 2.57 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|