C17H16FN5O3 — CID 122697222
(E)-3-[2-[5-fluoro-6-(2-hydroxypropoxy)-3-pyridinyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide (PubChem CID 122697222) has the molecular formula C17H16FN5O3 and a molecular weight of 357.35 g/mol. Its IUPAC name is (E)-3-[2-[5-fluoro-6-(2-hydroxypropoxy)-3-pyridinyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide.
| Compound Name | (E)-3-[2-[5-fluoro-6-(2-hydroxypropoxy)-3-pyridinyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide |
|---|---|
| PubChem CID | 122697222 |
| Molecular Formula | C17H16FN5O3 |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (E)-3-[2-[5-fluoro-6-(2-hydroxypropoxy)-3-pyridinyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide |
| SMILES | CC(O)COc1ncc(-c2cnc3[nH]cc(/C=C/C(N)=O)c3n2)cc1F |
| InChI | InChI=1S/C17H16FN5O3/c1-9(24)8-26-17-12(18)4-11(6-22-17)13-7-21-16-15(23-13)10(5-20-16)2-3-14(19)25/h2-7,9,24H,8H2,1H3,(H2,19,25)(H,20,21)/b3-2+ |
| InChIKey | IITDGTDZSUYZSP-NSCUHMNNSA-N |
| XLogP | 1.42 |
| TPSA | 127.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|