C16H10ClF3N4O — CID 118267793
(E)-3-[2-[3-chloro-5-(trifluoromethyl)phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide (PubChem CID 118267793) has the molecular formula C16H10ClF3N4O and a molecular weight of 366.73 g/mol. Its IUPAC name is (E)-3-[2-[3-chloro-5-(trifluoromethyl)phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide.
| Compound Name | (E)-3-[2-[3-chloro-5-(trifluoromethyl)phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide |
|---|---|
| PubChem CID | 118267793 |
| Molecular Formula | C16H10ClF3N4O |
| Molecular Weight | 366.73 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | (E)-3-[2-[3-chloro-5-(trifluoromethyl)phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide |
| SMILES | NC(=O)/C=C/c1c[nH]c2ncc(-c3cc(Cl)cc(C(F)(F)F)c3)nc12 |
| InChI | InChI=1S/C16H10ClF3N4O/c17-11-4-9(3-10(5-11)16(18,19)20)12-7-23-15-14(24-12)8(6-22-15)1-2-13(21)25/h1-7H,(H2,21,25)(H,22,23)/b2-1+ |
| InChIKey | GANPEMGJOZBEGC-OWOJBTEDSA-N |
| XLogP | 3.80 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.73 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|