C18H12ClN5O — CID 118267688
(E)-3-[2-(6-chloroquinolin-3-yl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide (PubChem CID 118267688) has the molecular formula C18H12ClN5O and a molecular weight of 349.78 g/mol. Its IUPAC name is (E)-3-[2-(6-chloroquinolin-3-yl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide.
| Compound Name | (E)-3-[2-(6-chloroquinolin-3-yl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide |
|---|---|
| PubChem CID | 118267688 |
| Molecular Formula | C18H12ClN5O |
| Molecular Weight | 349.78 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | (E)-3-[2-(6-chloroquinolin-3-yl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide |
| SMILES | NC(=O)/C=C/c1c[nH]c2ncc(-c3cnc4ccc(Cl)cc4c3)nc12 |
| InChI | InChI=1S/C18H12ClN5O/c19-13-2-3-14-11(6-13)5-12(8-21-14)15-9-23-18-17(24-15)10(7-22-18)1-4-16(20)25/h1-9H,(H2,20,25)(H,22,23)/b4-1+ |
| InChIKey | STZNFPCLBPYDES-DAFODLJHSA-N |
| XLogP | 3.33 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.78 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|