C17H17N5O3 — CID 118268014
(E)-3-[2-[6-[(2S)-2-hydroxypropoxy]-3-pyridinyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide (PubChem CID 118268014) has the molecular formula C17H17N5O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is (E)-3-[2-[6-[(2S)-2-hydroxypropoxy]-3-pyridinyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide.
| Compound Name | (E)-3-[2-[6-[(2S)-2-hydroxypropoxy]-3-pyridinyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide |
|---|---|
| PubChem CID | 118268014 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | (E)-3-[2-[6-[(2S)-2-hydroxypropoxy]-3-pyridinyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide |
| SMILES | C[C@H](O)COc1ccc(-c2cnc3[nH]cc(/C=C/C(N)=O)c3n2)cn1 |
| InChI | InChI=1S/C17H17N5O3/c1-10(23)9-25-15-5-3-11(6-19-15)13-8-21-17-16(22-13)12(7-20-17)2-4-14(18)24/h2-8,10,23H,9H2,1H3,(H2,18,24)(H,20,21)/b4-2+/t10-/m0/s1 |
| InChIKey | QXFQKIZKOUOKPC-YWNRKNDBSA-N |
| XLogP | 1.28 |
| TPSA | 127.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|