C12H9F3N2O2 — CID 71997113
2-cyano-3-[2-(2,2,2-trifluoroethoxy)phenyl]prop-2-enamide (PubChem CID 71997113) has the molecular formula C12H9F3N2O2 and a molecular weight of 270.21 g/mol. Its IUPAC name is 2-cyano-3-[2-(2,2,2-trifluoroethoxy)phenyl]prop-2-enamide.
| Compound Name | 2-cyano-3-[2-(2,2,2-trifluoroethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 71997113 |
| Molecular Formula | C12H9F3N2O2 |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 2-cyano-3-[2-(2,2,2-trifluoroethoxy)phenyl]prop-2-enamide |
| SMILES | N#CC(=Cc1ccccc1OCC(F)(F)F)C(N)=O |
| InChI | InChI=1S/C12H9F3N2O2/c13-12(14,15)7-19-10-4-2-1-3-8(10)5-9(6-16)11(17)18/h1-5H,7H2,(H2,17,18) |
| InChIKey | HJQKWRFDCMINRM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|