C21H16F3NO4 — CID 2821204
ethyl 2-[2-[2-cyano-3-oxo-3-[3-(trifluoromethyl)phenyl]prop-1-enyl]phenoxy]acetate (PubChem CID 2821204) has the molecular formula C21H16F3NO4 and a molecular weight of 403.36 g/mol. Its IUPAC name is ethyl 2-[2-[2-cyano-3-oxo-3-[3-(trifluoromethyl)phenyl]prop-1-enyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-[2-cyano-3-oxo-3-[3-(trifluoromethyl)phenyl]prop-1-enyl]phenoxy]acetate |
|---|---|
| PubChem CID | 2821204 |
| Molecular Formula | C21H16F3NO4 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | ethyl 2-[2-[2-cyano-3-oxo-3-[3-(trifluoromethyl)phenyl]prop-1-enyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccccc1C=C(C#N)C(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H16F3NO4/c1-2-28-19(26)13-29-18-9-4-3-6-14(18)10-16(12-25)20(27)15-7-5-8-17(11-15)21(22,23)24/h3-11H,2,13H2,1H3 |
| InChIKey | CPCOWXXQENUKEJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|