C14H16N2OS — CID 6211795
(E)-3-(2-butoxyphenyl)-2-cyanoprop-2-enethioamide (PubChem CID 6211795) has the molecular formula C14H16N2OS and a molecular weight of 260.36 g/mol. Its IUPAC name is (E)-3-(2-butoxyphenyl)-2-cyanoprop-2-enethioamide.
| Compound Name | (E)-3-(2-butoxyphenyl)-2-cyanoprop-2-enethioamide |
|---|---|
| PubChem CID | 6211795 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (E)-3-(2-butoxyphenyl)-2-cyanoprop-2-enethioamide |
| SMILES | CCCCOc1ccccc1/C=C(\C#N)C(N)=S |
| InChI | InChI=1S/C14H16N2OS/c1-2-3-8-17-13-7-5-4-6-11(13)9-12(10-15)14(16)18/h4-7,9H,2-3,8H2,1H3,(H2,16,18)/b12-9+ |
| InChIKey | JWIXQRIBJGVXJB-FMIVXFBMSA-N |
| XLogP | 3.06 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|