C23H25NO3 — CID 19206816
(4-tert-butylphenyl) (E)-2-cyano-3-(2-propoxyphenyl)prop-2-enoate (PubChem CID 19206816) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is (4-tert-butylphenyl) (E)-2-cyano-3-(2-propoxyphenyl)prop-2-enoate.
| Compound Name | (4-tert-butylphenyl) (E)-2-cyano-3-(2-propoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19206816 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (4-tert-butylphenyl) (E)-2-cyano-3-(2-propoxyphenyl)prop-2-enoate |
| SMILES | CCCOc1ccccc1/C=C(\C#N)C(=O)Oc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H25NO3/c1-5-14-26-21-9-7-6-8-17(21)15-18(16-24)22(25)27-20-12-10-19(11-13-20)23(2,3)4/h6-13,15H,5,14H2,1-4H3/b18-15+ |
| InChIKey | JHSUWGPWCICRSD-OBGWFSINSA-N |
| XLogP | 5.29 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|