C19H23N7O3 — CID 122697128
tert-butyl 4-[7-[(Z)-3-amino-2-cyano-3-oxoprop-1-enyl]-5H-pyrrolo[2,3-b]pyrazin-2-yl]piperazine-1-carboxylate (PubChem CID 122697128) has the molecular formula C19H23N7O3 and a molecular weight of 397.44 g/mol. Its IUPAC name is tert-butyl 4-[7-[(Z)-3-amino-2-cyano-3-oxoprop-1-enyl]-5H-pyrrolo[2,3-b]pyrazin-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[7-[(Z)-3-amino-2-cyano-3-oxoprop-1-enyl]-5H-pyrrolo[2,3-b]pyrazin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 122697128 |
| Molecular Formula | C19H23N7O3 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | tert-butyl 4-[7-[(Z)-3-amino-2-cyano-3-oxoprop-1-enyl]-5H-pyrrolo[2,3-b]pyrazin-2-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cnc3[nH]cc(/C=C(/C#N)C(N)=O)c3n2)CC1 |
| InChI | InChI=1S/C19H23N7O3/c1-19(2,3)29-18(28)26-6-4-25(5-7-26)14-11-23-17-15(24-14)13(10-22-17)8-12(9-20)16(21)27/h8,10-11H,4-7H2,1-3H3,(H2,21,27)(H,22,23)/b12-8- |
| InChIKey | OMWATMWBYDUJFQ-WQLSENKSSA-N |
| XLogP | 1.41 |
| TPSA | 141.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|