C21H25F3N6O2 — CID 118267673
(E)-3-[2-[4-[4-(trifluoromethyl)cyclohexanecarbonyl]piperazin-1-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide (PubChem CID 118267673) has the molecular formula C21H25F3N6O2 and a molecular weight of 450.47 g/mol. Its IUPAC name is (E)-3-[2-[4-[4-(trifluoromethyl)cyclohexanecarbonyl]piperazin-1-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide.
| Compound Name | (E)-3-[2-[4-[4-(trifluoromethyl)cyclohexanecarbonyl]piperazin-1-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide |
|---|---|
| PubChem CID | 118267673 |
| Molecular Formula | C21H25F3N6O2 |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | (E)-3-[2-[4-[4-(trifluoromethyl)cyclohexanecarbonyl]piperazin-1-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]prop-2-enamide |
| SMILES | NC(=O)/C=C/c1c[nH]c2ncc(N3CCN(C(=O)C4CCC(C(F)(F)F)CC4)CC3)nc12 |
| InChI | InChI=1S/C21H25F3N6O2/c22-21(23,24)15-4-1-13(2-5-15)20(32)30-9-7-29(8-10-30)17-12-27-19-18(28-17)14(11-26-19)3-6-16(25)31/h3,6,11-13,15H,1-2,4-5,7-10H2,(H2,25,31)(H,26,27)/b6-3+ |
| InChIKey | YQDNSMAENVHHMZ-ZZXKWVIFSA-N |
| XLogP | 2.47 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|