C18H14N4O — CID 118267459
(E)-2-acetyl-4-(2-phenyl-5H-pyrrolo[2,3-b]pyrazin-7-yl)but-2-enenitrile (PubChem CID 118267459) has the molecular formula C18H14N4O and a molecular weight of 302.34 g/mol. Its IUPAC name is (E)-2-acetyl-4-(2-phenyl-5H-pyrrolo[2,3-b]pyrazin-7-yl)but-2-enenitrile.
| Compound Name | (E)-2-acetyl-4-(2-phenyl-5H-pyrrolo[2,3-b]pyrazin-7-yl)but-2-enenitrile |
|---|---|
| PubChem CID | 118267459 |
| Molecular Formula | C18H14N4O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (E)-2-acetyl-4-(2-phenyl-5H-pyrrolo[2,3-b]pyrazin-7-yl)but-2-enenitrile |
| SMILES | CC(=O)/C(C#N)=C/Cc1c[nH]c2ncc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C18H14N4O/c1-12(23)14(9-19)7-8-15-10-20-18-17(15)22-16(11-21-18)13-5-3-2-4-6-13/h2-7,10-11H,8H2,1H3,(H,20,21)/b14-7+ |
| InChIKey | KPMLCYAAJIGQMR-VGOFMYFVSA-N |
| XLogP | 3.21 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|