C12H18N4 — CID 155187523
N-butyl-5-ethyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 155187523) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is N-butyl-5-ethyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-butyl-5-ethyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 155187523 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | N-butyl-5-ethyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CCCCNc1ncnc2[nH]cc(CC)c12 |
| InChI | InChI=1S/C12H18N4/c1-3-5-6-13-11-10-9(4-2)7-14-12(10)16-8-15-11/h7-8H,3-6H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | CNYYDXPDSSDFIU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|