C12H18N4O — CID 164977527
1-[4-(butylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]ethanol (PubChem CID 164977527) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-[4-(butylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]ethanol.
| Compound Name | 1-[4-(butylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]ethanol |
|---|---|
| PubChem CID | 164977527 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 1-[4-(butylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]ethanol |
| SMILES | CCCCNc1ncnc2[nH]cc(C(C)O)c12 |
| InChI | InChI=1S/C12H18N4O/c1-3-4-5-13-11-10-9(8(2)17)6-14-12(10)16-7-15-11/h6-8,17H,3-5H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | DZQIKZKYZBLDAM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|