C11H16N4 — CID 110430104
N-butyl-6-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 110430104) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is N-butyl-6-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-butyl-6-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 110430104 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | N-butyl-6-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CCCCNc1ncnc2[nH]c(C)cc12 |
| InChI | InChI=1S/C11H16N4/c1-3-4-5-12-10-9-6-8(2)15-11(9)14-7-13-10/h6-7H,3-5H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | SZZDQMHLAURIKN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|