C23H25Cl2N11 — CID 165069185
N-butyl-6-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine;4-chloro-6-methyl-7H-pyrrolo[2,3-d]pyrimidine;6-chloro-7H-purine (PubChem CID 165069185) has the molecular formula C23H25Cl2N11 and a molecular weight of 526.44 g/mol. Its IUPAC name is N-butyl-6-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine;4-chloro-6-methyl-7H-pyrrolo[2,3-d]pyrimidine;6-chloro-7H-purine.
| Compound Name | N-butyl-6-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine;4-chloro-6-methyl-7H-pyrrolo[2,3-d]pyrimidine;6-chloro-7H-purine |
|---|---|
| PubChem CID | 165069185 |
| Molecular Formula | C23H25Cl2N11 |
| Molecular Weight | 526.44 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | N-butyl-6-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine;4-chloro-6-methyl-7H-pyrrolo[2,3-d]pyrimidine;6-chloro-7H-purine |
| SMILES | CCCCNc1ncnc2[nH]c(C)cc12.Cc1cc2c(Cl)ncnc2[nH]1.Clc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C11H16N4.C7H6ClN3.C5H3ClN4/c1-3-4-5-12-10-9-6-8(2)15-11(9)14-7-13-10;1-4-2-5-6(8)9-3-10-7(5)11-4;6-4-3-5(9-1-7-3)10-2-8-4/h6-7H,3-5H2,1-2H3,(H2,12,13,14,15);2-3H,1H3,(H,9,10,11);1-2H,(H,7,8,9,10) |
| InChIKey | SLXMHCSCWJNDNC-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 149.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.44 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|