About 6-chloro-7H-purine;propan-2-one
6-chloro-7H-purine;propan-2-one (PubChem CID 87503855) has the molecular formula C8H9ClN4O
and a molecular weight of 212.64 g/mol. Its IUPAC name is 6-chloro-7H-purine;propan-2-one.
Molecular Properties
| Compound Name | 6-chloro-7H-purine;propan-2-one |
| PubChem CID | 87503855 |
| Molecular Formula | C8H9ClN4O |
| Molecular Weight | 212.64 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 6-chloro-7H-purine;propan-2-one |
| SMILES | CC(C)=O.Clc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C5H3ClN4.C3H6O/c6-4-3-5(9-1-7-3)10-2-8-4;1-3(2)4/h1-2H,(H,7,8,9,10);1-2H3 |
| InChIKey | DGWMGXMCXMILRH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.64 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chloro-7H-purine;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-7H-purine;propan-2-one?
The IUPAC name of 6-chloro-7H-purine;propan-2-one (CID 87503855) is 6-chloro-7H-purine;propan-2-one.
What is the SMILES notation for 6-chloro-7H-purine;propan-2-one?
The canonical SMILES for 6-chloro-7H-purine;propan-2-one is CC(C)=O.Clc1ncnc2nc[nH]c12.
What is the InChIKey of 6-chloro-7H-purine;propan-2-one?
The InChIKey is DGWMGXMCXMILRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3ClN4.C3H6O/c6-4-3-5(9-1-7-3)10-2-8-4;1-3(2)4/h1-2H,(H,7,8,9,10);1-2H3.
What are the key properties of 6-chloro-7H-purine;propan-2-one?
6-chloro-7H-purine;propan-2-one has a molecular weight of 212.64 g/mol, XLogP of 1.60, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-7H-purine;propan-2-one is sourced from PubChem (CID 87503855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).