C14H23ClN4O4 — CID 143417496
6-chloro-7H-purine;ethane;2-(hydroxymethyl)oxepane-3,4-diol (PubChem CID 143417496) has the molecular formula C14H23ClN4O4 and a molecular weight of 346.82 g/mol. Its IUPAC name is 6-chloro-7H-purine;ethane;2-(hydroxymethyl)oxepane-3,4-diol.
| Compound Name | 6-chloro-7H-purine;ethane;2-(hydroxymethyl)oxepane-3,4-diol |
|---|---|
| PubChem CID | 143417496 |
| Molecular Formula | C14H23ClN4O4 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 6-chloro-7H-purine;ethane;2-(hydroxymethyl)oxepane-3,4-diol |
| SMILES | CC.Clc1ncnc2nc[nH]c12.OCC1OCCCC(O)C1O |
| InChI | InChI=1S/C7H14O4.C5H3ClN4.C2H6/c8-4-6-7(10)5(9)2-1-3-11-6;6-4-3-5(9-1-7-3)10-2-8-4;1-2/h5-10H,1-4H2;1-2H,(H,7,8,9,10);1-2H3 |
| InChIKey | RIZQMUYFECCWTD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 124.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |