C10H11ClN4O3 — CID 124679420
(2R,3S,5S)-5-(6-chloro-7H-purin-8-yl)-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 124679420) has the molecular formula C10H11ClN4O3 and a molecular weight of 270.68 g/mol. Its IUPAC name is (2R,3S,5S)-5-(6-chloro-7H-purin-8-yl)-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5S)-5-(6-chloro-7H-purin-8-yl)-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 124679420 |
| Molecular Formula | C10H11ClN4O3 |
| Molecular Weight | 270.68 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | (2R,3S,5S)-5-(6-chloro-7H-purin-8-yl)-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | OC[C@H]1O[C@H](c2nc3ncnc(Cl)c3[nH]2)C[C@@H]1O |
| InChI | InChI=1S/C10H11ClN4O3/c11-8-7-10(13-3-12-8)15-9(14-7)5-1-4(17)6(2-16)18-5/h3-6,16-17H,1-2H2,(H,12,13,14,15)/t4-,5-,6+/m0/s1 |
| InChIKey | KJKLEZXDWNIDDY-HCWXCVPCSA-N |
| XLogP | 0.19 |
| TPSA | 104.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.68 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |