C15H15ClN2O3 — CID 71763397
(2R,3S,5R)-5-(2-chloro-6-pyridin-2-yl-3-pyridinyl)-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 71763397) has the molecular formula C15H15ClN2O3 and a molecular weight of 306.75 g/mol. Its IUPAC name is (2R,3S,5R)-5-(2-chloro-6-pyridin-2-yl-3-pyridinyl)-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-(2-chloro-6-pyridin-2-yl-3-pyridinyl)-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 71763397 |
| Molecular Formula | C15H15ClN2O3 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | (2R,3S,5R)-5-(2-chloro-6-pyridin-2-yl-3-pyridinyl)-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(-c3ccccn3)nc2Cl)C[C@@H]1O |
| InChI | InChI=1S/C15H15ClN2O3/c16-15-9(13-7-12(20)14(8-19)21-13)4-5-11(18-15)10-3-1-2-6-17-10/h1-6,12-14,19-20H,7-8H2/t12-,13+,14+/m0/s1 |
| InChIKey | WCEHFYNGIYKXES-BFHYXJOUSA-N |
| XLogP | 1.98 |
| TPSA | 75.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|