C19H18O3 — CID 23660970
(2R,3S,5R)-2-(hydroxymethyl)-5-phenanthren-1-yloxolan-3-ol (PubChem CID 23660970) has the molecular formula C19H18O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is (2R,3S,5R)-2-(hydroxymethyl)-5-phenanthren-1-yloxolan-3-ol.
| Compound Name | (2R,3S,5R)-2-(hydroxymethyl)-5-phenanthren-1-yloxolan-3-ol |
|---|---|
| PubChem CID | 23660970 |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (2R,3S,5R)-2-(hydroxymethyl)-5-phenanthren-1-yloxolan-3-ol |
| SMILES | OC[C@H]1O[C@@H](c2cccc3c2ccc2ccccc23)C[C@@H]1O |
| InChI | InChI=1S/C19H18O3/c20-11-19-17(21)10-18(22-19)16-7-3-6-14-13-5-2-1-4-12(13)8-9-15(14)16/h1-9,17-21H,10-11H2/t17-,18+,19+/m0/s1 |
| InChIKey | LRDPYZRWSDNAOZ-IPMKNSEASA-N |
| XLogP | 3.18 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|