C15H14O7 — CID 122496509
5-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxochromene-3-carboxylic acid (PubChem CID 122496509) has the molecular formula C15H14O7 and a molecular weight of 306.27 g/mol. Its IUPAC name is 5-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxochromene-3-carboxylic acid.
| Compound Name | 5-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxochromene-3-carboxylic acid |
|---|---|
| PubChem CID | 122496509 |
| Molecular Formula | C15H14O7 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 5-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxochromene-3-carboxylic acid |
| SMILES | O=C(O)c1cc2c([C@H]3C[C@@H](O)[C@@H](CO)O3)cccc2oc1=O |
| InChI | InChI=1S/C15H14O7/c16-6-13-10(17)5-12(21-13)7-2-1-3-11-8(7)4-9(14(18)19)15(20)22-11/h1-4,10,12-13,16-17H,5-6H2,(H,18,19)/t10-,12-,13-/m1/s1 |
| InChIKey | SRRVNQJBHGKMOV-RAIGVLPGSA-N |
| XLogP | 0.67 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|