C11H11F2IO3 — CID 24773387
(2R,3S,5R)-5-(2,4-difluoro-3-iodophenyl)-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 24773387) has the molecular formula C11H11F2IO3 and a molecular weight of 356.11 g/mol. Its IUPAC name is (2R,3S,5R)-5-(2,4-difluoro-3-iodophenyl)-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-(2,4-difluoro-3-iodophenyl)-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 24773387 |
| Molecular Formula | C11H11F2IO3 |
| Molecular Weight | 356.11 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | (2R,3S,5R)-5-(2,4-difluoro-3-iodophenyl)-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(F)c(I)c2F)C[C@@H]1O |
| InChI | InChI=1S/C11H11F2IO3/c12-6-2-1-5(10(13)11(6)14)8-3-7(16)9(4-15)17-8/h1-2,7-9,15-16H,3-4H2/t7-,8+,9+/m0/s1 |
| InChIKey | XOMUGEIOJPDZEJ-DJLDLDEBSA-N |
| XLogP | 1.75 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.11 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|