C13H14ClNO3 — CID 54757675
(2R,3S,5S)-5-(5-chloro-1H-indol-2-yl)-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 54757675) has the molecular formula C13H14ClNO3 and a molecular weight of 267.71 g/mol. Its IUPAC name is (2R,3S,5S)-5-(5-chloro-1H-indol-2-yl)-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5S)-5-(5-chloro-1H-indol-2-yl)-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 54757675 |
| Molecular Formula | C13H14ClNO3 |
| Molecular Weight | 267.71 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | (2R,3S,5S)-5-(5-chloro-1H-indol-2-yl)-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | OC[C@H]1O[C@H](c2cc3cc(Cl)ccc3[nH]2)C[C@@H]1O |
| InChI | InChI=1S/C13H14ClNO3/c14-8-1-2-9-7(3-8)4-10(15-9)12-5-11(17)13(6-16)18-12/h1-4,11-13,15-17H,5-6H2/t11-,12-,13+/m0/s1 |
| InChIKey | OZFHIGUNQAZYRR-RWMBFGLXSA-N |
| XLogP | 2.00 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.71 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |