C17H18N2O3 — CID 59119138
(2R,3R,5R)-2-(hydroxymethyl)-5-(4-phenyldiazenylphenyl)oxolan-3-ol (PubChem CID 59119138) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is (2R,3R,5R)-2-(hydroxymethyl)-5-(4-phenyldiazenylphenyl)oxolan-3-ol.
| Compound Name | (2R,3R,5R)-2-(hydroxymethyl)-5-(4-phenyldiazenylphenyl)oxolan-3-ol |
|---|---|
| PubChem CID | 59119138 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | (2R,3R,5R)-2-(hydroxymethyl)-5-(4-phenyldiazenylphenyl)oxolan-3-ol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(/N=N/c3ccccc3)cc2)C[C@H]1O |
| InChI | InChI=1S/C17H18N2O3/c20-11-17-15(21)10-16(22-17)12-6-8-14(9-7-12)19-18-13-4-2-1-3-5-13/h1-9,15-17,20-21H,10-11H2/b19-18+/t15-,16-,17-/m1/s1 |
| InChIKey | CWOQXDCOGLAETI-JKCWEYPVSA-N |
| XLogP | 3.29 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|