C18H17NO3 — CID 59119117
(2R,3R,5R)-5-acridin-3-yl-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 59119117) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is (2R,3R,5R)-5-acridin-3-yl-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,5R)-5-acridin-3-yl-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 59119117 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | (2R,3R,5R)-5-acridin-3-yl-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | OC[C@H]1O[C@@H](c2ccc3cc4ccccc4nc3c2)C[C@H]1O |
| InChI | InChI=1S/C18H17NO3/c20-10-18-16(21)9-17(22-18)13-6-5-12-7-11-3-1-2-4-14(11)19-15(12)8-13/h1-8,16-18,20-21H,9-10H2/t16-,17-,18-/m1/s1 |
| InChIKey | HEHKNYDCGOMXIL-KZNAEPCWSA-N |
| XLogP | 2.57 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|