C21H20O3 — CID 23661140
(2R,3S,5R)-2-(hydroxymethyl)-5-(7-phenylnaphthalen-2-yl)oxolan-3-ol (PubChem CID 23661140) has the molecular formula C21H20O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is (2R,3S,5R)-2-(hydroxymethyl)-5-(7-phenylnaphthalen-2-yl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-2-(hydroxymethyl)-5-(7-phenylnaphthalen-2-yl)oxolan-3-ol |
|---|---|
| PubChem CID | 23661140 |
| Molecular Formula | C21H20O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | (2R,3S,5R)-2-(hydroxymethyl)-5-(7-phenylnaphthalen-2-yl)oxolan-3-ol |
| SMILES | OC[C@H]1O[C@@H](c2ccc3ccc(-c4ccccc4)cc3c2)C[C@@H]1O |
| InChI | InChI=1S/C21H20O3/c22-13-21-19(23)12-20(24-21)17-9-7-15-6-8-16(10-18(15)11-17)14-4-2-1-3-5-14/h1-11,19-23H,12-13H2/t19-,20+,21+/m0/s1 |
| InChIKey | KTPSKQWMQOOHCX-PWRODBHTSA-N |
| XLogP | 3.69 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |