C15H16O3 — CID 174024474
(3R,5R)-2-(hydroxymethyl)-5-naphthalen-1-yloxolan-3-ol (PubChem CID 174024474) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (3R,5R)-2-(hydroxymethyl)-5-naphthalen-1-yloxolan-3-ol.
| Compound Name | (3R,5R)-2-(hydroxymethyl)-5-naphthalen-1-yloxolan-3-ol |
|---|---|
| PubChem CID | 174024474 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (3R,5R)-2-(hydroxymethyl)-5-naphthalen-1-yloxolan-3-ol |
| SMILES | OCC1O[C@@H](c2cccc3ccccc23)C[C@H]1O |
| InChI | InChI=1S/C15H16O3/c16-9-15-13(17)8-14(18-15)12-7-3-5-10-4-1-2-6-11(10)12/h1-7,13-17H,8-9H2/t13-,14-,15?/m1/s1 |
| InChIKey | ZXLOKLHRVRKUJB-GRKKQISMSA-N |
| XLogP | 2.02 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |