C13H13F2IO3 — CID 6479208
(2R,3S,5R)-5-[2,4-difluoro-5-[(E)-2-iodoethenyl]phenyl]-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 6479208) has the molecular formula C13H13F2IO3 and a molecular weight of 382.14 g/mol. Its IUPAC name is (2R,3S,5R)-5-[2,4-difluoro-5-[(E)-2-iodoethenyl]phenyl]-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-[2,4-difluoro-5-[(E)-2-iodoethenyl]phenyl]-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 6479208 |
| Molecular Formula | C13H13F2IO3 |
| Molecular Weight | 382.14 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | (2R,3S,5R)-5-[2,4-difluoro-5-[(E)-2-iodoethenyl]phenyl]-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | OC[C@H]1O[C@@H](c2cc(/C=C/I)c(F)cc2F)C[C@@H]1O |
| InChI | InChI=1S/C13H13F2IO3/c14-9-4-10(15)8(3-7(9)1-2-16)12-5-11(18)13(6-17)19-12/h1-4,11-13,17-18H,5-6H2/b2-1+/t11-,12+,13+/m0/s1 |
| InChIKey | BIXXMOJLIZPULX-HROLJSSSSA-N |
| XLogP | 2.55 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.14 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|