C11H11BrF2O3 — CID 502251
(2R,3S,5S)-5-(5-bromo-2,4-difluorophenyl)-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 502251) has the molecular formula C11H11BrF2O3 and a molecular weight of 309.11 g/mol. Its IUPAC name is (2R,3S,5S)-5-(5-bromo-2,4-difluorophenyl)-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5S)-5-(5-bromo-2,4-difluorophenyl)-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 502251 |
| Molecular Formula | C11H11BrF2O3 |
| Molecular Weight | 309.11 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | (2R,3S,5S)-5-(5-bromo-2,4-difluorophenyl)-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | OC[C@H]1O[C@H](c2cc(Br)c(F)cc2F)C[C@@H]1O |
| InChI | InChI=1S/C11H11BrF2O3/c12-6-1-5(7(13)2-8(6)14)10-3-9(16)11(4-15)17-10/h1-2,9-11,15-16H,3-4H2/t9-,10-,11+/m0/s1 |
| InChIKey | CYVRADZAOPPRMO-GARJFASQSA-N |
| XLogP | 1.91 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.11 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|