C18H38O4 — CID 176704923
1,5-dimethylcyclooctane;ethane;(2R)-2-(hydroxymethyl)oxane-3,4-diol (PubChem CID 176704923) has the molecular formula C18H38O4 and a molecular weight of 318.50 g/mol. Its IUPAC name is 1,5-dimethylcyclooctane;ethane;(2R)-2-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | 1,5-dimethylcyclooctane;ethane;(2R)-2-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 176704923 |
| Molecular Formula | C18H38O4 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.28 |
| IUPAC Name | 1,5-dimethylcyclooctane;ethane;(2R)-2-(hydroxymethyl)oxane-3,4-diol |
| SMILES | CC.CC1CCCC(C)CCC1.OC[C@H]1OCCC(O)C1O |
| InChI | InChI=1S/C10H20.C6H12O4.C2H6/c1-9-5-3-7-10(2)8-4-6-9;7-3-5-6(9)4(8)1-2-10-5;1-2/h9-10H,3-8H2,1-2H3;4-9H,1-3H2;1-2H3/t;4?,5-,6?;/m.1./s1 |
| InChIKey | WZTKDIGGUOFCRU-KABCWARXSA-N |
| XLogP | 3.13 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |