C12H28N2O4 — CID 166480153
(Z)-but-1-ene-1,2-diamine;ethane;2-(hydroxymethyl)oxane-3,4-diol (PubChem CID 166480153) has the molecular formula C12H28N2O4 and a molecular weight of 264.37 g/mol. Its IUPAC name is (Z)-but-1-ene-1,2-diamine;ethane;2-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (Z)-but-1-ene-1,2-diamine;ethane;2-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 166480153 |
| Molecular Formula | C12H28N2O4 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | (Z)-but-1-ene-1,2-diamine;ethane;2-(hydroxymethyl)oxane-3,4-diol |
| SMILES | CC.CC/C(N)=C/N.OCC1OCCC(O)C1O |
| InChI | InChI=1S/C6H12O4.C4H10N2.C2H6/c7-3-5-6(9)4(8)1-2-10-5;1-2-4(6)3-5;1-2/h4-9H,1-3H2;3H,2,5-6H2,1H3;1-2H3/b;4-3-; |
| InChIKey | VQOULGSYPIPBIF-LWFKIUJUSA-N |
| XLogP | -0.33 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |