About 2-(hydroxymethyl)oxolan-3-ol;methanethiol
2-(hydroxymethyl)oxolan-3-ol;methanethiol (PubChem CID 172622049) has the molecular formula C6H14O3S
and a molecular weight of 166.24 g/mol. Its IUPAC name is 2-(hydroxymethyl)oxolan-3-ol;methanethiol.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)oxolan-3-ol;methanethiol |
| PubChem CID | 172622049 |
| Molecular Formula | C6H14O3S |
| Molecular Weight | 166.24 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 2-(hydroxymethyl)oxolan-3-ol;methanethiol |
| SMILES | CS.OCC1OCCC1O |
| InChI | InChI=1S/C5H10O3.CH4S/c6-3-5-4(7)1-2-8-5;1-2/h4-7H,1-3H2;2H,1H3 |
| InChIKey | YEGDKEWDPMOXEP-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.24 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(hydroxymethyl)oxolan-3-ol;methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)oxolan-3-ol;methanethiol?
The IUPAC name of 2-(hydroxymethyl)oxolan-3-ol;methanethiol (CID 172622049) is 2-(hydroxymethyl)oxolan-3-ol;methanethiol.
What is the SMILES notation for 2-(hydroxymethyl)oxolan-3-ol;methanethiol?
The canonical SMILES for 2-(hydroxymethyl)oxolan-3-ol;methanethiol is CS.OCC1OCCC1O.
What is the InChIKey of 2-(hydroxymethyl)oxolan-3-ol;methanethiol?
The InChIKey is YEGDKEWDPMOXEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3.CH4S/c6-3-5-4(7)1-2-8-5;1-2/h4-7H,1-3H2;2H,1H3.
What are the key properties of 2-(hydroxymethyl)oxolan-3-ol;methanethiol?
2-(hydroxymethyl)oxolan-3-ol;methanethiol has a molecular weight of 166.24 g/mol, XLogP of -0.33, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)oxolan-3-ol;methanethiol is sourced from PubChem (CID 172622049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).