C10H19O8P — CID 101369485
[(2S,3R)-2-(hydroxymethyl)oxolan-3-yl] [(2S,3S)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 101369485) has the molecular formula C10H19O8P and a molecular weight of 298.23 g/mol. Its IUPAC name is [(2S,3R)-2-(hydroxymethyl)oxolan-3-yl] [(2S,3S)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2S,3R)-2-(hydroxymethyl)oxolan-3-yl] [(2S,3S)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 101369485 |
| Molecular Formula | C10H19O8P |
| Molecular Weight | 298.23 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | [(2S,3R)-2-(hydroxymethyl)oxolan-3-yl] [(2S,3S)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | O=P(O)(OC[C@@H]1OCC[C@@H]1O)O[C@@H]1CCO[C@H]1CO |
| InChI | InChI=1S/C10H19O8P/c11-5-9-8(2-4-15-9)18-19(13,14)17-6-10-7(12)1-3-16-10/h7-12H,1-6H2,(H,13,14)/t7-,8+,9-,10-/m0/s1 |
| InChIKey | OGXNUYSXHHDRHD-JXUBOQSCSA-N |
| XLogP | -0.58 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.23 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|