C12H23N4O8P — CID 174033171
[(2R,5R)-5-(aminomethylideneamino)-2-(hydroxymethyl)oxolan-3-yl] [(2R,5R)-5-(aminomethylideneamino)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 174033171) has the molecular formula C12H23N4O8P and a molecular weight of 382.31 g/mol. Its IUPAC name is [(2R,5R)-5-(aminomethylideneamino)-2-(hydroxymethyl)oxolan-3-yl] [(2R,5R)-5-(aminomethylideneamino)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2R,5R)-5-(aminomethylideneamino)-2-(hydroxymethyl)oxolan-3-yl] [(2R,5R)-5-(aminomethylideneamino)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 174033171 |
| Molecular Formula | C12H23N4O8P |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | [(2R,5R)-5-(aminomethylideneamino)-2-(hydroxymethyl)oxolan-3-yl] [(2R,5R)-5-(aminomethylideneamino)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | NC=N[C@H]1CC(O)[C@@H](COP(=O)(O)OC2C[C@H](N=CN)O[C@@H]2CO)O1 |
| InChI | InChI=1S/C12H23N4O8P/c13-5-15-11-1-7(18)10(23-11)4-21-25(19,20)24-8-2-12(16-6-14)22-9(8)3-17/h5-12,17-18H,1-4H2,(H2,13,15)(H2,14,16)(H,19,20)/t7?,8?,9-,10-,11-,12-/m1/s1 |
| InChIKey | RRLHOUILCGQFIT-IVWMKOAXSA-N |
| XLogP | -1.95 |
| TPSA | 191.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|