C15H23FN3O8PS — CID 167592048
[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxythiolan-2-yl]methyl [(2R,3S,5S)-2-(hydroxymethyl)-5-methyloxolan-3-yl] hydrogen phosphate (PubChem CID 167592048) has the molecular formula C15H23FN3O8PS and a molecular weight of 455.40 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxythiolan-2-yl]methyl [(2R,3S,5S)-2-(hydroxymethyl)-5-methyloxolan-3-yl] hydrogen phosphate.
| Compound Name | [(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxythiolan-2-yl]methyl [(2R,3S,5S)-2-(hydroxymethyl)-5-methyloxolan-3-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 167592048 |
| Molecular Formula | C15H23FN3O8PS |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | [(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxythiolan-2-yl]methyl [(2R,3S,5S)-2-(hydroxymethyl)-5-methyloxolan-3-yl] hydrogen phosphate |
| SMILES | C[C@H]1C[C@H](OP(=O)(O)OC[C@H]2S[C@@H](n3ccc(N)nc3=O)[C@@H](F)[C@@H]2O)[C@@H](CO)O1 |
| InChI | InChI=1S/C15H23FN3O8PS/c1-7-4-8(9(5-20)26-7)27-28(23,24)25-6-10-13(21)12(16)14(29-10)19-3-2-11(17)18-15(19)22/h2-3,7-10,12-14,20-21H,4-6H2,1H3,(H,23,24)(H2,17,18,22)/t7-,8-,9+,10+,12-,13+,14+/m0/s1 |
| InChIKey | WJHZMFLDSFODJX-DWGSOIQOSA-N |
| XLogP | -0.19 |
| TPSA | 166.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|