C15H27O7PS — CID 161283653
(2R)-2-[[[(2R)-2-(hydroxymethyl)oxolan-3-yl]oxy-[(E)-pent-3-enyl]sulfanylphosphoryl]oxymethyl]oxolan-3-ol (PubChem CID 161283653) has the molecular formula C15H27O7PS and a molecular weight of 382.42 g/mol. Its IUPAC name is (2R)-2-[[[(2R)-2-(hydroxymethyl)oxolan-3-yl]oxy-[(E)-pent-3-enyl]sulfanylphosphoryl]oxymethyl]oxolan-3-ol.
| Compound Name | (2R)-2-[[[(2R)-2-(hydroxymethyl)oxolan-3-yl]oxy-[(E)-pent-3-enyl]sulfanylphosphoryl]oxymethyl]oxolan-3-ol |
|---|---|
| PubChem CID | 161283653 |
| Molecular Formula | C15H27O7PS |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | (2R)-2-[[[(2R)-2-(hydroxymethyl)oxolan-3-yl]oxy-[(E)-pent-3-enyl]sulfanylphosphoryl]oxymethyl]oxolan-3-ol |
| SMILES | C/C=C/CCS[P@@](=O)(OC[C@H]1OCCC1O)OC1CCO[C@@H]1CO |
| InChI | InChI=1S/C15H27O7PS/c1-2-3-4-9-24-23(18,21-11-15-12(17)5-7-20-15)22-13-6-8-19-14(13)10-16/h2-3,12-17H,4-11H2,1H3/b3-2+/t12?,13?,14-,15-,23+/m1/s1 |
| InChIKey | STAABMGSPAENNA-YMPZZXGDSA-N |
| XLogP | 2.13 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|