About [(2R,3S)-2-(methoxymethyl)oxolan-3-yl] methyl phosphate
[(2R,3S)-2-(methoxymethyl)oxolan-3-yl] methyl phosphate (PubChem CID 140824432) has the molecular formula C7H14O6P-
and a molecular weight of 225.16 g/mol. Its IUPAC name is [(2R,3S)-2-(methoxymethyl)oxolan-3-yl] methyl phosphate.
Molecular Properties
| Compound Name | [(2R,3S)-2-(methoxymethyl)oxolan-3-yl] methyl phosphate |
| PubChem CID | 140824432 |
| Molecular Formula | C7H14O6P- |
| Molecular Weight | 225.16 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | [(2R,3S)-2-(methoxymethyl)oxolan-3-yl] methyl phosphate |
| SMILES | COC[C@H]1OCC[C@@H]1OP(=O)([O-])OC |
| InChI | InChI=1S/C7H15O6P/c1-10-5-7-6(3-4-12-7)13-14(8,9)11-2/h6-7H,3-5H2,1-2H3,(H,8,9)/p-1/t6-,7+/m0/s1 |
| InChIKey | PFIWAMCNJVZOBN-NKWVEPMBSA-M |
| XLogP | -0.08 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.16 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(2R,3S)-2-(methoxymethyl)oxolan-3-yl] methyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3S)-2-(methoxymethyl)oxolan-3-yl] methyl phosphate?
The IUPAC name of [(2R,3S)-2-(methoxymethyl)oxolan-3-yl] methyl phosphate (CID 140824432) is [(2R,3S)-2-(methoxymethyl)oxolan-3-yl] methyl phosphate.
What is the SMILES notation for [(2R,3S)-2-(methoxymethyl)oxolan-3-yl] methyl phosphate?
The canonical SMILES for [(2R,3S)-2-(methoxymethyl)oxolan-3-yl] methyl phosphate is COC[C@H]1OCC[C@@H]1OP(=O)([O-])OC.
What is the InChIKey of [(2R,3S)-2-(methoxymethyl)oxolan-3-yl] methyl phosphate?
The InChIKey is PFIWAMCNJVZOBN-NKWVEPMBSA-M. The full InChI is InChI=1S/C7H15O6P/c1-10-5-7-6(3-4-12-7)13-14(8,9)11-2/h6-7H,3-5H2,1-2H3,(H,8,9)/p-1/t6-,7+/m0/s1.
What are the key properties of [(2R,3S)-2-(methoxymethyl)oxolan-3-yl] methyl phosphate?
[(2R,3S)-2-(methoxymethyl)oxolan-3-yl] methyl phosphate has a molecular weight of 225.16 g/mol, XLogP of -0.08, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3S)-2-(methoxymethyl)oxolan-3-yl] methyl phosphate is sourced from PubChem (CID 140824432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).