C12H24O5P- — CID 167605809
(2R)-3-[methanidyl(propan-2-yloxy)phosphoryl]oxy-2-(propan-2-yloxymethyl)oxolane (PubChem CID 167605809) has the molecular formula C12H24O5P- and a molecular weight of 279.29 g/mol. Its IUPAC name is (2R)-3-[methanidyl(propan-2-yloxy)phosphoryl]oxy-2-(propan-2-yloxymethyl)oxolane.
| Compound Name | (2R)-3-[methanidyl(propan-2-yloxy)phosphoryl]oxy-2-(propan-2-yloxymethyl)oxolane |
|---|---|
| PubChem CID | 167605809 |
| Molecular Formula | C12H24O5P- |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | (2R)-3-[methanidyl(propan-2-yloxy)phosphoryl]oxy-2-(propan-2-yloxymethyl)oxolane |
| SMILES | [CH2-]P(=O)(OC(C)C)OC1CCO[C@@H]1COC(C)C |
| InChI | InChI=1S/C12H24O5P/c1-9(2)15-8-12-11(6-7-14-12)17-18(5,13)16-10(3)4/h9-12H,5-8H2,1-4H3/q-1/t11?,12-,18?/m1/s1 |
| InChIKey | KJBOJGOFUAFCPS-BJCXPLBRSA-N |
| XLogP | 3.00 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|