C5H10O3 — CID 21120394
(2S,3R)-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 21120394) has the molecular formula C5H10O3 and a molecular weight of 118.13 g/mol. Its IUPAC name is (2S,3R)-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2S,3R)-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 21120394 |
| Molecular Formula | C5H10O3 |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | (2S,3R)-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | OC[C@@H]1OCC[C@H]1O |
| InChI | InChI=1S/C5H10O3/c6-3-5-4(7)1-2-8-5/h4-7H,1-3H2/t4-,5+/m1/s1 |
| InChIKey | NSMOSDAEGJTOIQ-UHNVWZDZSA-N |
| XLogP | -0.87 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.13 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |